C16H20N6O3 — CID 30295899
[2-[(1-cyclopentyltetrazol-5-yl)methylcarbamoylamino]phenyl] acetate (PubChem CID 30295899) has the molecular formula C16H20N6O3 and a molecular weight of 344.38 g/mol. Its IUPAC name is [2-[(1-cyclopentyltetrazol-5-yl)methylcarbamoylamino]phenyl] acetate.
| Compound Name | [2-[(1-cyclopentyltetrazol-5-yl)methylcarbamoylamino]phenyl] acetate |
|---|---|
| PubChem CID | 30295899 |
| Molecular Formula | C16H20N6O3 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | [2-[(1-cyclopentyltetrazol-5-yl)methylcarbamoylamino]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1NC(=O)NCc1nnnn1C1CCCC1 |
| InChI | InChI=1S/C16H20N6O3/c1-11(23)25-14-9-5-4-8-13(14)18-16(24)17-10-15-19-20-21-22(15)12-6-2-3-7-12/h4-5,8-9,12H,2-3,6-7,10H2,1H3,(H2,17,18,24) |
| InChIKey | YZHKQMLDVSQFCR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|