C16H21N5O3 — CID 30295515
N-[(1-cyclopentyltetrazol-5-yl)methyl]-2-(4-methoxyphenoxy)acetamide (PubChem CID 30295515) has the molecular formula C16H21N5O3 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-[(1-cyclopentyltetrazol-5-yl)methyl]-2-(4-methoxyphenoxy)acetamide.
| Compound Name | N-[(1-cyclopentyltetrazol-5-yl)methyl]-2-(4-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 30295515 |
| Molecular Formula | C16H21N5O3 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | N-[(1-cyclopentyltetrazol-5-yl)methyl]-2-(4-methoxyphenoxy)acetamide |
| SMILES | COc1ccc(OCC(=O)NCc2nnnn2C2CCCC2)cc1 |
| InChI | InChI=1S/C16H21N5O3/c1-23-13-6-8-14(9-7-13)24-11-16(22)17-10-15-18-19-20-21(15)12-4-2-3-5-12/h6-9,12H,2-5,10-11H2,1H3,(H,17,22) |
| InChIKey | ZOEIKICKYSWACO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 91.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |