C19H28N6O3 — CID 3702393
ethyl 4-[5-[[1-(4-methoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate (PubChem CID 3702393) has the molecular formula C19H28N6O3 and a molecular weight of 388.47 g/mol. Its IUPAC name is ethyl 4-[5-[[1-(4-methoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-[[1-(4-methoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3702393 |
| Molecular Formula | C19H28N6O3 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | ethyl 4-[5-[[1-(4-methoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(n2nnnc2CNC(C)c2ccc(OC)cc2)CC1 |
| InChI | InChI=1S/C19H28N6O3/c1-4-28-19(26)24-11-9-16(10-12-24)25-18(21-22-23-25)13-20-14(2)15-5-7-17(27-3)8-6-15/h5-8,14,16,20H,4,9-13H2,1-3H3 |
| InChIKey | RFFDILGZGCHBCS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |