C20H30N6O4 — CID 3417660
ethyl 4-[5-[[2-(2,3-dimethoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate (PubChem CID 3417660) has the molecular formula C20H30N6O4 and a molecular weight of 418.50 g/mol. Its IUPAC name is ethyl 4-[5-[[2-(2,3-dimethoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[5-[[2-(2,3-dimethoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 3417660 |
| Molecular Formula | C20H30N6O4 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | ethyl 4-[5-[[2-(2,3-dimethoxyphenyl)ethylamino]methyl]tetrazol-1-yl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(n2nnnc2CNCCc2cccc(OC)c2OC)CC1 |
| InChI | InChI=1S/C20H30N6O4/c1-4-30-20(27)25-12-9-16(10-13-25)26-18(22-23-24-26)14-21-11-8-15-6-5-7-17(28-2)19(15)29-3/h5-7,16,21H,4,8-14H2,1-3H3 |
| InChIKey | LIYAPKBJOUWZPS-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 103.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|