C17H24N4O4 — CID 55392997
(1-butyltetrazol-5-yl)methyl 3-(2,3-dimethoxyphenyl)propanoate (PubChem CID 55392997) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (1-butyltetrazol-5-yl)methyl 3-(2,3-dimethoxyphenyl)propanoate.
| Compound Name | (1-butyltetrazol-5-yl)methyl 3-(2,3-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 55392997 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (1-butyltetrazol-5-yl)methyl 3-(2,3-dimethoxyphenyl)propanoate |
| SMILES | CCCCn1nnnc1COC(=O)CCc1cccc(OC)c1OC |
| InChI | InChI=1S/C17H24N4O4/c1-4-5-11-21-15(18-19-20-21)12-25-16(22)10-9-13-7-6-8-14(23-2)17(13)24-3/h6-8H,4-5,9-12H2,1-3H3 |
| InChIKey | VAXDKUBVNMBMKR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 88.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |