C17H18ClNO4 — CID 55546324
(6-chloro-3-pyridinyl)methyl 3-(2,3-dimethoxyphenyl)propanoate (PubChem CID 55546324) has the molecular formula C17H18ClNO4 and a molecular weight of 335.79 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 3-(2,3-dimethoxyphenyl)propanoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 3-(2,3-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 55546324 |
| Molecular Formula | C17H18ClNO4 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 3-(2,3-dimethoxyphenyl)propanoate |
| SMILES | COc1cccc(CCC(=O)OCc2ccc(Cl)nc2)c1OC |
| InChI | InChI=1S/C17H18ClNO4/c1-21-14-5-3-4-13(17(14)22-2)7-9-16(20)23-11-12-6-8-15(18)19-10-12/h3-6,8,10H,7,9,11H2,1-2H3 |
| InChIKey | DGSZMNWDGFEMIV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|