C12H18ClNO3 — CID 67393300
1-amino-4-(2,3-dimethoxyphenyl)butan-2-one;hydrochloride (PubChem CID 67393300) has the molecular formula C12H18ClNO3 and a molecular weight of 259.73 g/mol. Its IUPAC name is 1-amino-4-(2,3-dimethoxyphenyl)butan-2-one;hydrochloride.
| Compound Name | 1-amino-4-(2,3-dimethoxyphenyl)butan-2-one;hydrochloride |
|---|---|
| PubChem CID | 67393300 |
| Molecular Formula | C12H18ClNO3 |
| Molecular Weight | 259.73 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 1-amino-4-(2,3-dimethoxyphenyl)butan-2-one;hydrochloride |
| SMILES | COc1cccc(CCC(=O)CN)c1OC.Cl |
| InChI | InChI=1S/C12H17NO3.ClH/c1-15-11-5-3-4-9(12(11)16-2)6-7-10(14)8-13;/h3-5H,6-8,13H2,1-2H3;1H |
| InChIKey | RAAMGRJIFLUHBX-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.73 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |