C16H22O4 — CID 11265908
methyl (E)-7-(2,3-dimethoxyphenyl)hept-4-enoate (PubChem CID 11265908) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is methyl (E)-7-(2,3-dimethoxyphenyl)hept-4-enoate.
| Compound Name | methyl (E)-7-(2,3-dimethoxyphenyl)hept-4-enoate |
|---|---|
| PubChem CID | 11265908 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | methyl (E)-7-(2,3-dimethoxyphenyl)hept-4-enoate |
| SMILES | COC(=O)CC/C=C/CCc1cccc(OC)c1OC |
| InChI | InChI=1S/C16H22O4/c1-18-14-11-8-10-13(16(14)20-3)9-6-4-5-7-12-15(17)19-2/h4-5,8,10-11H,6-7,9,12H2,1-3H3/b5-4+ |
| InChIKey | LOCKVULALBPESI-SNAWJCMRSA-N |
| XLogP | 3.15 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|