About dimethyl (E)-oct-4-enedioate
dimethyl (E)-oct-4-enedioate (PubChem CID 15585051) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is dimethyl (E)-oct-4-enedioate.
Molecular Properties
| Compound Name | dimethyl (E)-oct-4-enedioate |
| PubChem CID | 15585051 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | dimethyl (E)-oct-4-enedioate |
| SMILES | COC(=O)CC/C=C/CCC(=O)OC |
| InChI | InChI=1S/C10H16O4/c1-13-9(11)7-5-3-4-6-8-10(12)14-2/h3-4H,5-8H2,1-2H3/b4-3+ |
| InChIKey | OBUKBMOOXPTJOJ-ONEGZZNKSA-N |
| XLogP | 1.45 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze dimethyl (E)-oct-4-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl (E)-oct-4-enedioate?
The IUPAC name of dimethyl (E)-oct-4-enedioate (CID 15585051) is dimethyl (E)-oct-4-enedioate.
What is the SMILES notation for dimethyl (E)-oct-4-enedioate?
The canonical SMILES for dimethyl (E)-oct-4-enedioate is COC(=O)CC/C=C/CCC(=O)OC.
What is the InChIKey of dimethyl (E)-oct-4-enedioate?
The InChIKey is OBUKBMOOXPTJOJ-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H16O4/c1-13-9(11)7-5-3-4-6-8-10(12)14-2/h3-4H,5-8H2,1-2H3/b4-3+.
What are the key properties of dimethyl (E)-oct-4-enedioate?
dimethyl (E)-oct-4-enedioate has a molecular weight of 200.23 g/mol, XLogP of 1.45, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl (E)-oct-4-enedioate is sourced from PubChem (CID 15585051), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).