C16H24O3 — CID 15484485
methyl (4E,9E,11E,13Z)-15-hydroxypentadeca-4,9,11,13-tetraenoate (PubChem CID 15484485) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl (4E,9E,11E,13Z)-15-hydroxypentadeca-4,9,11,13-tetraenoate.
| Compound Name | methyl (4E,9E,11E,13Z)-15-hydroxypentadeca-4,9,11,13-tetraenoate |
|---|---|
| PubChem CID | 15484485 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | methyl (4E,9E,11E,13Z)-15-hydroxypentadeca-4,9,11,13-tetraenoate |
| SMILES | COC(=O)CC/C=C/CCC/C=C/C=C/C=C\CO |
| InChI | InChI=1S/C16H24O3/c1-19-16(18)14-12-10-8-6-4-2-3-5-7-9-11-13-15-17/h3,5,7-11,13,17H,2,4,6,12,14-15H2,1H3/b5-3+,9-7+,10-8+,13-11- |
| InChIKey | ZJMSWQFRJODPRS-YSSVKQDFSA-N |
| XLogP | 3.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|