C34H54O4 — CID 12073776
dimethyl (11E,13E,15E,17E,19E,21E)-dotriaconta-11,13,15,17,19,21-hexaenedioate (PubChem CID 12073776) has the molecular formula C34H54O4 and a molecular weight of 526.80 g/mol. Its IUPAC name is dimethyl (11E,13E,15E,17E,19E,21E)-dotriaconta-11,13,15,17,19,21-hexaenedioate.
| Compound Name | dimethyl (11E,13E,15E,17E,19E,21E)-dotriaconta-11,13,15,17,19,21-hexaenedioate |
|---|---|
| PubChem CID | 12073776 |
| Molecular Formula | C34H54O4 |
| Molecular Weight | 526.80 g/mol |
| Exact Mass | 526.40 |
| IUPAC Name | dimethyl (11E,13E,15E,17E,19E,21E)-dotriaconta-11,13,15,17,19,21-hexaenedioate |
| SMILES | COC(=O)CCCCCCCCC/C=C/C=C/C=C/C=C/C=C/C=C/CCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C34H54O4/c1-37-33(35)31-29-27-25-23-21-19-17-15-13-11-9-7-5-3-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34(36)38-2/h3-14H,15-32H2,1-2H3/b5-3+,6-4+,9-7+,10-8+,13-11+,14-12+ |
| InChIKey | XHODOPUQZWYEDW-PXNMIUTMSA-N |
| XLogP | 9.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.80 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|