C19H32O2 — CID 6433658
methyl (9E,11E,13E)-octadeca-9,11,13-trienoate (PubChem CID 6433658) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is methyl (9E,11E,13E)-octadeca-9,11,13-trienoate.
| Compound Name | methyl (9E,11E,13E)-octadeca-9,11,13-trienoate |
|---|---|
| PubChem CID | 6433658 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | methyl (9E,11E,13E)-octadeca-9,11,13-trienoate |
| SMILES | CCCC/C=C/C=C/C=C/CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h6-11H,3-5,12-18H2,1-2H3/b7-6+,9-8+,11-10+ |
| InChIKey | KOJYENXGDXRGDK-OBWVEWQSSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|