C22H26FeO7 — CID 10983357
carbon monoxide;iron;15-O-methyl 1-O-prop-2-enyl (2Z,4E,6E,11E)-pentadeca-2,4,6,11-tetraenedioate (PubChem CID 10983357) has the molecular formula C22H26FeO7 and a molecular weight of 458.29 g/mol. Its IUPAC name is carbon monoxide;iron;15-O-methyl 1-O-prop-2-enyl (2Z,4E,6E,11E)-pentadeca-2,4,6,11-tetraenedioate.
| Compound Name | carbon monoxide;iron;15-O-methyl 1-O-prop-2-enyl (2Z,4E,6E,11E)-pentadeca-2,4,6,11-tetraenedioate |
|---|---|
| PubChem CID | 10983357 |
| Molecular Formula | C22H26FeO7 |
| Molecular Weight | 458.29 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | carbon monoxide;iron;15-O-methyl 1-O-prop-2-enyl (2Z,4E,6E,11E)-pentadeca-2,4,6,11-tetraenedioate |
| SMILES | C=CCOC(=O)/C=C\C=C\C=C\CCC/C=C/CCC(=O)OC.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Fe] |
| InChI | InChI=1S/C19H26O4.3CO.Fe/c1-3-17-23-19(21)16-14-12-10-8-6-4-5-7-9-11-13-15-18(20)22-2;3*1-2;/h3,6,8-12,14,16H,1,4-5,7,13,15,17H2,2H3;;;;/b8-6+,11-9+,12-10+,16-14-;;;; |
| InChIKey | NRDRJYAIMAHGRZ-IYQWGNJGSA-N |
| XLogP | 3.95 |
| TPSA | 112.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|