C35H52O2 — CID 10255583
methyl (4Z,7Z,10Z,13Z,16Z,19Z,22Z,25Z,28Z)-tetratriaconta-4,7,10,13,16,19,22,25,28-nonaenoate (PubChem CID 10255583) has the molecular formula C35H52O2 and a molecular weight of 504.80 g/mol. Its IUPAC name is methyl (4Z,7Z,10Z,13Z,16Z,19Z,22Z,25Z,28Z)-tetratriaconta-4,7,10,13,16,19,22,25,28-nonaenoate.
| Compound Name | methyl (4Z,7Z,10Z,13Z,16Z,19Z,22Z,25Z,28Z)-tetratriaconta-4,7,10,13,16,19,22,25,28-nonaenoate |
|---|---|
| PubChem CID | 10255583 |
| Molecular Formula | C35H52O2 |
| Molecular Weight | 504.80 g/mol |
| Exact Mass | 504.40 |
| IUPAC Name | methyl (4Z,7Z,10Z,13Z,16Z,19Z,22Z,25Z,28Z)-tetratriaconta-4,7,10,13,16,19,22,25,28-nonaenoate |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)OC |
| InChI | InChI=1S/C35H52O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30-31-32-33-34-35(36)37-2/h7-8,10-11,13-14,16-17,19-20,22-23,25-26,28-29,31-32H,3-6,9,12,15,18,21,24,27,30,33-34H2,1-2H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22-,26-25-,29-28-,32-31- |
| InChIKey | UAFRNGUVHUSFEF-IQFZLKMYSA-N |
| XLogP | 10.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.80 |
| LogP ≤ 5 | 10.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|