C19H33ClO2 — CID 162316575
methyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate;hydrochloride (PubChem CID 162316575) has the molecular formula C19H33ClO2 and a molecular weight of 328.92 g/mol. Its IUPAC name is methyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate;hydrochloride.
| Compound Name | methyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate;hydrochloride |
|---|---|
| PubChem CID | 162316575 |
| Molecular Formula | C19H33ClO2 |
| Molecular Weight | 328.92 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | methyl (6Z,9Z,12Z)-octadeca-6,9,12-trienoate;hydrochloride |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)OC.Cl |
| InChI | InChI=1S/C19H32O2.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2;/h7-8,10-11,13-14H,3-6,9,12,15-18H2,1-2H3;1H/b8-7-,11-10-,14-13-; |
| InChIKey | SOYKAAFSVKXRKT-NPSXTYMCSA-N |
| XLogP | 6.17 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.92 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|