C57H102O6 — CID 159619579
methyl (9E,12E)-octadeca-9,12-dienoate;methyl (9E,12E,15E)-octadeca-9,12,15-trienoate;methyl (E)-octadec-9-enoate (PubChem CID 159619579) has the molecular formula C57H102O6 and a molecular weight of 883.44 g/mol. Its IUPAC name is methyl (9E,12E)-octadeca-9,12-dienoate;methyl (9E,12E,15E)-octadeca-9,12,15-trienoate;methyl (E)-octadec-9-enoate.
| Compound Name | methyl (9E,12E)-octadeca-9,12-dienoate;methyl (9E,12E,15E)-octadeca-9,12,15-trienoate;methyl (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 159619579 |
| Molecular Formula | C57H102O6 |
| Molecular Weight | 883.44 g/mol |
| Exact Mass | 882.77 |
| IUPAC Name | methyl (9E,12E)-octadeca-9,12-dienoate;methyl (9E,12E,15E)-octadeca-9,12,15-trienoate;methyl (E)-octadec-9-enoate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCC(=O)OC.CCCCC/C=C/C/C=C/CCCCCCCC(=O)OC.CCCCCCCC/C=C/CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H36O2.C19H34O2.C19H32O2/c3*1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2/h10-11H,3-9,12-18H2,1-2H3;7-8,10-11H,3-6,9,12-18H2,1-2H3;4-5,7-8,10-11H,3,6,9,12-18H2,1-2H3/b11-10+;8-7+,11-10+;5-4+,8-7+,11-10+ |
| InChIKey | MNSKDQORRUSYGV-MZKCTTOQSA-N |
| XLogP | 17.92 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 883.44 |
| LogP ≤ 5 | 17.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|