C37H68O4 — CID 88695330
methyl octadecanoate;(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid (PubChem CID 88695330) has the molecular formula C37H68O4 and a molecular weight of 576.95 g/mol. Its IUPAC name is methyl octadecanoate;(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid.
| Compound Name | methyl octadecanoate;(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid |
|---|---|
| PubChem CID | 88695330 |
| Molecular Formula | C37H68O4 |
| Molecular Weight | 576.95 g/mol |
| Exact Mass | 576.51 |
| IUPAC Name | methyl octadecanoate;(9Z,12Z,15Z)-octadeca-9,12,15-trienoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)O.CCCCCCCCCCCCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H38O2.C18H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(20)21-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h3-18H2,1-2H3;3-4,6-7,9-10H,2,5,8,11-17H2,1H3,(H,19,20)/b;4-3-,7-6-,10-9- |
| InChIKey | UZAWKGGAXVBSJJ-JVKRUYCISA-N |
| XLogP | 12.08 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.95 |
| LogP ≤ 5 | 12.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|