C23H38O2 — CID 10472831
methyl (10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoate (PubChem CID 10472831) has the molecular formula C23H38O2 and a molecular weight of 346.56 g/mol. Its IUPAC name is methyl (10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoate.
| Compound Name | methyl (10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoate |
|---|---|
| PubChem CID | 10472831 |
| Molecular Formula | C23H38O2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.29 |
| IUPAC Name | methyl (10E,13E,16E,19E)-docosa-10,13,16,19-tetraenoate |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C23H38O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23(24)25-2/h4-5,7-8,10-11,13-14H,3,6,9,12,15-22H2,1-2H3/b5-4+,8-7+,11-10+,14-13+ |
| InChIKey | XKZIJJIPQXQYBG-ARQYDCTJSA-N |
| XLogP | 7.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|