C58H92O5 — CID 174823698
icosa-5,8,11,14-tetraenoic acid;[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] icosa-5,8,11,14-tetraenoate (PubChem CID 174823698) has the molecular formula C58H92O5 and a molecular weight of 869.37 g/mol. Its IUPAC name is icosa-5,8,11,14-tetraenoic acid;[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] icosa-5,8,11,14-tetraenoate.
| Compound Name | icosa-5,8,11,14-tetraenoic acid;[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] icosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 174823698 |
| Molecular Formula | C58H92O5 |
| Molecular Weight | 869.37 g/mol |
| Exact Mass | 868.69 |
| IUPAC Name | icosa-5,8,11,14-tetraenoic acid;[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl] icosa-5,8,11,14-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)OC(=O)CCCC=CCC=CCC=CCC=CCCCCC.CCCCCC=CCC=CCC=CCC=CCCCC(=O)O |
| InChI | InChI=1S/C38H60O3.C20H32O2/c1-3-5-7-9-11-13-15-17-19-20-22-24-26-28-30-32-34-36-38(40)41-37(39)35-33-31-29-27-25-23-21-18-16-14-12-10-8-6-4-2;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h6,8,11-14,17-19,21-22,24,28,30H,3-5,7,9-10,15-16,20,23,25-27,29,31-36H2,1-2H3;6-7,9-10,12-13,15-16H,2-5,8,11,14,17-19H2,1H3,(H,21,22)/b8-6-,13-11?,14-12-,19-17?,21-18-,24-22?,30-28?; |
| InChIKey | VEMVDTXMNGNTEL-RFODXXGWSA-N |
| XLogP | 18.01 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.37 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|