C36H58O3 — CID 87579236
[(6E,9E,12E)-octadeca-6,9,12-trienoyl] (6E,9E,12E)-octadeca-6,9,12-trienoate (PubChem CID 87579236) has the molecular formula C36H58O3 and a molecular weight of 538.86 g/mol. Its IUPAC name is [(6E,9E,12E)-octadeca-6,9,12-trienoyl] (6E,9E,12E)-octadeca-6,9,12-trienoate.
| Compound Name | [(6E,9E,12E)-octadeca-6,9,12-trienoyl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 87579236 |
| Molecular Formula | C36H58O3 |
| Molecular Weight | 538.86 g/mol |
| Exact Mass | 538.44 |
| IUPAC Name | [(6E,9E,12E)-octadeca-6,9,12-trienoyl] (6E,9E,12E)-octadeca-6,9,12-trienoate |
| SMILES | CCCCC/C=C/C/C=C/C/C=C/CCCCC(=O)OC(=O)CCCC/C=C/C/C=C/C/C=C/CCCCC |
| InChI | InChI=1S/C36H58O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,23-26H,3-10,15-16,21-22,27-34H2,1-2H3/b13-11+,14-12+,19-17+,20-18+,25-23+,26-24+ |
| InChIKey | VXINNLYURLBLAO-ICJFPOBSSA-N |
| XLogP | 11.24 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.86 |
| LogP ≤ 5 | 11.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|