About cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate
cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate (PubChem CID 174884194) has the molecular formula C36H66Cd2O3
and a molecular weight of 771.74 g/mol. Its IUPAC name is cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate.
Molecular Properties
| Compound Name | cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate |
| PubChem CID | 174884194 |
| Molecular Formula | C36H66Cd2O3 |
| Molecular Weight | 771.74 g/mol |
| Exact Mass | 774.31 |
| IUPAC Name | cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cd].[Cd] |
| InChI | InChI=1S/C36H66O3.2Cd/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;;/h17-20H,3-16,21-34H2,1-2H3;;/b19-17-,20-18-;; |
| InChIKey | XDKOOOWSIBOFKN-AXMZSLBLSA-N |
| XLogP | 12.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 771.74 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate?
The IUPAC name of cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate (CID 174884194) is cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate.
What is the SMILES notation for cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate?
The canonical SMILES for cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate is CCCCCCCC/C=C\CCCCCCCC(=O)OC(=O)CCCCCCC/C=C\CCCCCCCC.[Cd].[Cd].
What is the InChIKey of cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate?
The InChIKey is XDKOOOWSIBOFKN-AXMZSLBLSA-N. The full InChI is InChI=1S/C36H66O3.2Cd/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;;/h17-20H,3-16,21-34H2,1-2H3;;/b19-17-,20-18-;;.
What are the key properties of cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate?
cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate has a molecular weight of 771.74 g/mol, XLogP of 12.13, 30 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cadmium;[(Z)-octadec-9-enoyl] (Z)-octadec-9-enoate is sourced from PubChem (CID 174884194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).