About azane;[(Z)-octadec-9-enoyl] octadec-9-enoate
azane;[(Z)-octadec-9-enoyl] octadec-9-enoate (PubChem CID 134587557) has the molecular formula C36H69NO3
and a molecular weight of 563.95 g/mol. Its IUPAC name is azane;[(Z)-octadec-9-enoyl] octadec-9-enoate.
Molecular Properties
| Compound Name | azane;[(Z)-octadec-9-enoyl] octadec-9-enoate |
| PubChem CID | 134587557 |
| Molecular Formula | C36H69NO3 |
| Molecular Weight | 563.95 g/mol |
| Exact Mass | 563.53 |
| IUPAC Name | azane;[(Z)-octadec-9-enoyl] octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(=O)CCCCCCC/C=C\CCCCCCCC.N |
| InChI | InChI=1S/C36H66O3.H3N/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20H,3-16,21-34H2,1-2H3;1H3/b19-17-,20-18?; |
| InChIKey | YBPUCJYMANORAS-RZWGDHLJSA-N |
| XLogP | 12.29 |
| TPSA | 78.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.95 |
| LogP ≤ 5 | 12.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze azane;[(Z)-octadec-9-enoyl] octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;[(Z)-octadec-9-enoyl] octadec-9-enoate?
The IUPAC name of azane;[(Z)-octadec-9-enoyl] octadec-9-enoate (CID 134587557) is azane;[(Z)-octadec-9-enoyl] octadec-9-enoate.
What is the SMILES notation for azane;[(Z)-octadec-9-enoyl] octadec-9-enoate?
The canonical SMILES for azane;[(Z)-octadec-9-enoyl] octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OC(=O)CCCCCCC/C=C\CCCCCCCC.N.
What is the InChIKey of azane;[(Z)-octadec-9-enoyl] octadec-9-enoate?
The InChIKey is YBPUCJYMANORAS-RZWGDHLJSA-N. The full InChI is InChI=1S/C36H66O3.H3N/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;/h17-20H,3-16,21-34H2,1-2H3;1H3/b19-17-,20-18?;.
What are the key properties of azane;[(Z)-octadec-9-enoyl] octadec-9-enoate?
azane;[(Z)-octadec-9-enoyl] octadec-9-enoate has a molecular weight of 563.95 g/mol, XLogP of 12.29, 30 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;[(Z)-octadec-9-enoyl] octadec-9-enoate is sourced from PubChem (CID 134587557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).