About sodium;hydride;octadec-9-enoyl octadec-9-enoate
sodium;hydride;octadec-9-enoyl octadec-9-enoate (PubChem CID 173290321) has the molecular formula C36H67NaO3
and a molecular weight of 570.92 g/mol. Its IUPAC name is sodium;hydride;octadec-9-enoyl octadec-9-enoate.
Molecular Properties
| Compound Name | sodium;hydride;octadec-9-enoyl octadec-9-enoate |
| PubChem CID | 173290321 |
| Molecular Formula | C36H67NaO3 |
| Molecular Weight | 570.92 g/mol |
| Exact Mass | 570.50 |
| IUPAC Name | sodium;hydride;octadec-9-enoyl octadec-9-enoate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(=O)CCCCCCCC=CCCCCCCCC.[H-].[Na+] |
| InChI | InChI=1S/C36H66O3.Na.H/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;;/h17-20H,3-16,21-34H2,1-2H3;;/q;+1;-1 |
| InChIKey | DSGICODXGCLHMA-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 570.92 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;octadec-9-enoyl octadec-9-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;octadec-9-enoyl octadec-9-enoate?
The IUPAC name of sodium;hydride;octadec-9-enoyl octadec-9-enoate (CID 173290321) is sodium;hydride;octadec-9-enoyl octadec-9-enoate.
What is the SMILES notation for sodium;hydride;octadec-9-enoyl octadec-9-enoate?
The canonical SMILES for sodium;hydride;octadec-9-enoyl octadec-9-enoate is CCCCCCCCC=CCCCCCCCC(=O)OC(=O)CCCCCCCC=CCCCCCCCC.[H-].[Na+].
What is the InChIKey of sodium;hydride;octadec-9-enoyl octadec-9-enoate?
The InChIKey is DSGICODXGCLHMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H66O3.Na.H/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35(37)39-36(38)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2;;/h17-20H,3-16,21-34H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;octadec-9-enoyl octadec-9-enoate?
sodium;hydride;octadec-9-enoyl octadec-9-enoate has a molecular weight of 570.92 g/mol, XLogP of 9.25, 30 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;octadec-9-enoyl octadec-9-enoate is sourced from PubChem (CID 173290321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).