C12H17ClO4 — CID 139764480
4-(2,3-dimethoxyphenyl)butanoic acid;hydrochloride (PubChem CID 139764480) has the molecular formula C12H17ClO4 and a molecular weight of 260.72 g/mol. Its IUPAC name is 4-(2,3-dimethoxyphenyl)butanoic acid;hydrochloride.
| Compound Name | 4-(2,3-dimethoxyphenyl)butanoic acid;hydrochloride |
|---|---|
| PubChem CID | 139764480 |
| Molecular Formula | C12H17ClO4 |
| Molecular Weight | 260.72 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 4-(2,3-dimethoxyphenyl)butanoic acid;hydrochloride |
| SMILES | COc1cccc(CCCC(=O)O)c1OC.Cl |
| InChI | InChI=1S/C12H16O4.ClH/c1-15-10-7-3-5-9(12(10)16-2)6-4-8-11(13)14;/h3,5,7H,4,6,8H2,1-2H3,(H,13,14);1H |
| InChIKey | PVXMHLUUUZBSIK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.72 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |