C18H20O3 — CID 22324958
4-(2-benzyl-3-methoxyphenyl)butanoic acid (PubChem CID 22324958) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is 4-(2-benzyl-3-methoxyphenyl)butanoic acid.
| Compound Name | 4-(2-benzyl-3-methoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 22324958 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 4-(2-benzyl-3-methoxyphenyl)butanoic acid |
| SMILES | COc1cccc(CCCC(=O)O)c1Cc1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-21-17-11-5-9-15(10-6-12-18(19)20)16(17)13-14-7-3-2-4-8-14/h2-5,7-9,11H,6,10,12-13H2,1H3,(H,19,20) |
| InChIKey | FWVGIFXRXGEEHL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |