C22H30O — CID 70537049
3-benzyl-1,2-dibutyl-4-methoxybenzene (PubChem CID 70537049) has the molecular formula C22H30O and a molecular weight of 310.48 g/mol. Its IUPAC name is 3-benzyl-1,2-dibutyl-4-methoxybenzene.
| Compound Name | 3-benzyl-1,2-dibutyl-4-methoxybenzene |
|---|---|
| PubChem CID | 70537049 |
| Molecular Formula | C22H30O |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 3-benzyl-1,2-dibutyl-4-methoxybenzene |
| SMILES | CCCCc1ccc(OC)c(Cc2ccccc2)c1CCCC |
| InChI | InChI=1S/C22H30O/c1-4-6-13-19-15-16-22(23-3)21(20(19)14-7-5-2)17-18-11-9-8-10-12-18/h8-12,15-16H,4-7,13-14,17H2,1-3H3 |
| InChIKey | QGIQMNDESPRJTB-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |