C13H20O — CID 150631165
2-butyl-1-methoxy-3,4-dimethylbenzene (PubChem CID 150631165) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is 2-butyl-1-methoxy-3,4-dimethylbenzene.
| Compound Name | 2-butyl-1-methoxy-3,4-dimethylbenzene |
|---|---|
| PubChem CID | 150631165 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 2-butyl-1-methoxy-3,4-dimethylbenzene |
| SMILES | CCCCc1c(OC)ccc(C)c1C |
| InChI | InChI=1S/C13H20O/c1-5-6-7-12-11(3)10(2)8-9-13(12)14-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | IXXLBJMSMCCVEX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |