C15H24O2 — CID 524849
2-hexyl-1,3-dimethoxy-4-methylbenzene (PubChem CID 524849) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is 2-hexyl-1,3-dimethoxy-4-methylbenzene.
| Compound Name | 2-hexyl-1,3-dimethoxy-4-methylbenzene |
|---|---|
| PubChem CID | 524849 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | 2-hexyl-1,3-dimethoxy-4-methylbenzene |
| SMILES | CCCCCCc1c(OC)ccc(C)c1OC |
| InChI | InChI=1S/C15H24O2/c1-5-6-7-8-9-13-14(16-3)11-10-12(2)15(13)17-4/h10-11H,5-9H2,1-4H3 |
| InChIKey | JIIWWHDBTRDWIU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|