C16H26O2 — CID 162495747
1,3-dibutyl-2,4-dimethoxybenzene (PubChem CID 162495747) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is 1,3-dibutyl-2,4-dimethoxybenzene.
| Compound Name | 1,3-dibutyl-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 162495747 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | 1,3-dibutyl-2,4-dimethoxybenzene |
| SMILES | CCCCc1ccc(OC)c(CCCC)c1OC |
| InChI | InChI=1S/C16H26O2/c1-5-7-9-13-11-12-15(17-3)14(10-8-6-2)16(13)18-4/h11-12H,5-10H2,1-4H3 |
| InChIKey | DOBJOYUYBQNELQ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |