C14H23BO4 — CID 66930879
(3-hexyl-2,6-dimethoxyphenyl)boronic acid (PubChem CID 66930879) has the molecular formula C14H23BO4 and a molecular weight of 266.15 g/mol. Its IUPAC name is (3-hexyl-2,6-dimethoxyphenyl)boronic acid.
| Compound Name | (3-hexyl-2,6-dimethoxyphenyl)boronic acid |
|---|---|
| PubChem CID | 66930879 |
| Molecular Formula | C14H23BO4 |
| Molecular Weight | 266.15 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | (3-hexyl-2,6-dimethoxyphenyl)boronic acid |
| SMILES | CCCCCCc1ccc(OC)c(B(O)O)c1OC |
| InChI | InChI=1S/C14H23BO4/c1-4-5-6-7-8-11-9-10-12(18-2)13(15(16)17)14(11)19-3/h9-10,16-17H,4-8H2,1-3H3 |
| InChIKey | YUEBUCBWIZGKAG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|