C18H30O2 — CID 524862
1-decyl-2,4-dimethoxybenzene (PubChem CID 524862) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 1-decyl-2,4-dimethoxybenzene.
| Compound Name | 1-decyl-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 524862 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 1-decyl-2,4-dimethoxybenzene |
| SMILES | CCCCCCCCCCc1ccc(OC)cc1OC |
| InChI | InChI=1S/C18H30O2/c1-4-5-6-7-8-9-10-11-12-16-13-14-17(19-2)15-18(16)20-3/h13-15H,4-12H2,1-3H3 |
| InChIKey | ASWJLVTWCMPSNO-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|