C15H24O — CID 153315966
1,2-dibutyl-4-methoxybenzene (PubChem CID 153315966) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1,2-dibutyl-4-methoxybenzene.
| Compound Name | 1,2-dibutyl-4-methoxybenzene |
|---|---|
| PubChem CID | 153315966 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1,2-dibutyl-4-methoxybenzene |
| SMILES | CCCCc1ccc(OC)cc1CCCC |
| InChI | InChI=1S/C15H24O/c1-4-6-8-13-10-11-15(16-3)12-14(13)9-7-5-2/h10-12H,4-9H2,1-3H3 |
| InChIKey | AGTNXVJBTPBXBX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |