C20H34O2 — CID 154145604
1-hexyl-2,4-bis[(2-methylpropan-2-yl)oxy]benzene (PubChem CID 154145604) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 1-hexyl-2,4-bis[(2-methylpropan-2-yl)oxy]benzene.
| Compound Name | 1-hexyl-2,4-bis[(2-methylpropan-2-yl)oxy]benzene |
|---|---|
| PubChem CID | 154145604 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 1-hexyl-2,4-bis[(2-methylpropan-2-yl)oxy]benzene |
| SMILES | CCCCCCc1ccc(OC(C)(C)C)cc1OC(C)(C)C |
| InChI | InChI=1S/C20H34O2/c1-8-9-10-11-12-16-13-14-17(21-19(2,3)4)15-18(16)22-20(5,6)7/h13-15H,8-12H2,1-7H3 |
| InChIKey | YZFRNUOKTMUQTQ-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|