C18H30 — CID 54478491
2,3-dimethyl-1,4-dipentylbenzene (PubChem CID 54478491) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dipentylbenzene.
| Compound Name | 2,3-dimethyl-1,4-dipentylbenzene |
|---|---|
| PubChem CID | 54478491 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 2,3-dimethyl-1,4-dipentylbenzene |
| SMILES | CCCCCc1ccc(CCCCC)c(C)c1C |
| InChI | InChI=1S/C18H30/c1-5-7-9-11-17-13-14-18(12-10-8-6-2)16(4)15(17)3/h13-14H,5-12H2,1-4H3 |
| InChIKey | XNHMEKVKNMRJKN-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|