About tris(4-butyl-2,3-dimethylphenyl)borane
tris(4-butyl-2,3-dimethylphenyl)borane (PubChem CID 158974695) has the molecular formula C36H51B
and a molecular weight of 494.62 g/mol. Its IUPAC name is tris(4-butyl-2,3-dimethylphenyl)borane.
Molecular Properties
| Compound Name | tris(4-butyl-2,3-dimethylphenyl)borane |
| PubChem CID | 158974695 |
| Molecular Formula | C36H51B |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | tris(4-butyl-2,3-dimethylphenyl)borane |
| SMILES | CCCCc1ccc(B(c2ccc(CCCC)c(C)c2C)c2ccc(CCCC)c(C)c2C)c(C)c1C |
| InChI | InChI=1S/C36H51B/c1-10-13-16-31-19-22-34(28(7)25(31)4)37(35-23-20-32(17-14-11-2)26(5)29(35)8)36-24-21-33(18-15-12-3)27(6)30(36)9/h19-24H,10-18H2,1-9H3 |
| InChIKey | JOFZSQIYQKSZLR-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tris(4-butyl-2,3-dimethylphenyl)borane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(4-butyl-2,3-dimethylphenyl)borane?
The IUPAC name of tris(4-butyl-2,3-dimethylphenyl)borane (CID 158974695) is tris(4-butyl-2,3-dimethylphenyl)borane.
What is the SMILES notation for tris(4-butyl-2,3-dimethylphenyl)borane?
The canonical SMILES for tris(4-butyl-2,3-dimethylphenyl)borane is CCCCc1ccc(B(c2ccc(CCCC)c(C)c2C)c2ccc(CCCC)c(C)c2C)c(C)c1C.
What is the InChIKey of tris(4-butyl-2,3-dimethylphenyl)borane?
The InChIKey is JOFZSQIYQKSZLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C36H51B/c1-10-13-16-31-19-22-34(28(7)25(31)4)37(35-23-20-32(17-14-11-2)26(5)29(35)8)36-24-21-33(18-15-12-3)27(6)30(36)9/h19-24H,10-18H2,1-9H3.
What are the key properties of tris(4-butyl-2,3-dimethylphenyl)borane?
tris(4-butyl-2,3-dimethylphenyl)borane has a molecular weight of 494.62 g/mol, XLogP of 8.08, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tris(4-butyl-2,3-dimethylphenyl)borane is sourced from PubChem (CID 158974695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).