C18H35NO — CID 174675361
azane;1-decyl-2,3-dimethylbenzene;hydrate (PubChem CID 174675361) has the molecular formula C18H35NO and a molecular weight of 281.48 g/mol. Its IUPAC name is azane;1-decyl-2,3-dimethylbenzene;hydrate.
| Compound Name | azane;1-decyl-2,3-dimethylbenzene;hydrate |
|---|---|
| PubChem CID | 174675361 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | azane;1-decyl-2,3-dimethylbenzene;hydrate |
| SMILES | CCCCCCCCCCc1cccc(C)c1C.N.O |
| InChI | InChI=1S/C18H30.H3N.H2O/c1-4-5-6-7-8-9-10-11-14-18-15-12-13-16(2)17(18)3;;/h12-13,15H,4-11,14H2,1-3H3;1H3;1H2 |
| InChIKey | BVYIUEDPUMSHPO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 66.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|