C19H32 — CID 15920121
1,2-dihexyl-3-methylbenzene (PubChem CID 15920121) has the molecular formula C19H32 and a molecular weight of 260.46 g/mol. Its IUPAC name is 1,2-dihexyl-3-methylbenzene.
| Compound Name | 1,2-dihexyl-3-methylbenzene |
|---|---|
| PubChem CID | 15920121 |
| Molecular Formula | C19H32 |
| Molecular Weight | 260.46 g/mol |
| Exact Mass | 260.25 |
| IUPAC Name | 1,2-dihexyl-3-methylbenzene |
| SMILES | CCCCCCc1cccc(C)c1CCCCCC |
| InChI | InChI=1S/C19H32/c1-4-6-8-10-14-18-15-12-13-17(3)19(18)16-11-9-7-5-2/h12-13,15H,4-11,14,16H2,1-3H3 |
| InChIKey | RXUCANIYIXQZFZ-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.46 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|