C37H62 — CID 161479121
1,2-dipentylbenzene;1,2,3-tripentylbenzene (PubChem CID 161479121) has the molecular formula C37H62 and a molecular weight of 506.90 g/mol. Its IUPAC name is 1,2-dipentylbenzene;1,2,3-tripentylbenzene.
| Compound Name | 1,2-dipentylbenzene;1,2,3-tripentylbenzene |
|---|---|
| PubChem CID | 161479121 |
| Molecular Formula | C37H62 |
| Molecular Weight | 506.90 g/mol |
| Exact Mass | 506.49 |
| IUPAC Name | 1,2-dipentylbenzene;1,2,3-tripentylbenzene |
| SMILES | CCCCCc1cccc(CCCCC)c1CCCCC.CCCCCc1ccccc1CCCCC |
| InChI | InChI=1S/C21H36.C16H26/c1-4-7-10-14-19-16-13-17-20(15-11-8-5-2)21(19)18-12-9-6-3;1-3-5-7-11-15-13-9-10-14-16(15)12-8-6-4-2/h13,16-17H,4-12,14-15,18H2,1-3H3;9-10,13-14H,3-8,11-12H2,1-2H3 |
| InChIKey | WECRLSSVRJTDAN-UHFFFAOYSA-N |
| XLogP | 12.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.90 |
| LogP ≤ 5 | 12.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|