About 1-dodecyl-2-hexylbenzene
1-dodecyl-2-hexylbenzene (PubChem CID 19371073) has the molecular formula C24H42
and a molecular weight of 330.60 g/mol. Its IUPAC name is 1-dodecyl-2-hexylbenzene.
Molecular Properties
| Compound Name | 1-dodecyl-2-hexylbenzene |
| PubChem CID | 19371073 |
| Molecular Formula | C24H42 |
| Molecular Weight | 330.60 g/mol |
| Exact Mass | 330.33 |
| IUPAC Name | 1-dodecyl-2-hexylbenzene |
| SMILES | CCCCCCCCCCCCc1ccccc1CCCCCC |
| InChI | InChI=1S/C24H42/c1-3-5-7-9-10-11-12-13-14-16-20-24-22-18-17-21-23(24)19-15-8-6-4-2/h17-18,21-22H,3-16,19-20H2,1-2H3 |
| InChIKey | VOBUDMNPKBHJHC-UHFFFAOYSA-N |
| XLogP | 8.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.60 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-dodecyl-2-hexylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dodecyl-2-hexylbenzene?
The IUPAC name of 1-dodecyl-2-hexylbenzene (CID 19371073) is 1-dodecyl-2-hexylbenzene.
What is the SMILES notation for 1-dodecyl-2-hexylbenzene?
The canonical SMILES for 1-dodecyl-2-hexylbenzene is CCCCCCCCCCCCc1ccccc1CCCCCC.
What is the InChIKey of 1-dodecyl-2-hexylbenzene?
The InChIKey is VOBUDMNPKBHJHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42/c1-3-5-7-9-10-11-12-13-14-16-20-24-22-18-17-21-23(24)19-15-8-6-4-2/h17-18,21-22H,3-16,19-20H2,1-2H3.
What are the key properties of 1-dodecyl-2-hexylbenzene?
1-dodecyl-2-hexylbenzene has a molecular weight of 330.60 g/mol, XLogP of 8.27, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dodecyl-2-hexylbenzene is sourced from PubChem (CID 19371073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).