C19H32O3 — CID 174444225
carbonic acid;1,2-dihexylbenzene (PubChem CID 174444225) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is carbonic acid;1,2-dihexylbenzene.
| Compound Name | carbonic acid;1,2-dihexylbenzene |
|---|---|
| PubChem CID | 174444225 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | carbonic acid;1,2-dihexylbenzene |
| SMILES | CCCCCCc1ccccc1CCCCCC.O=C(O)O |
| InChI | InChI=1S/C18H30.CH2O3/c1-3-5-7-9-13-17-15-11-12-16-18(17)14-10-8-6-4-2;2-1(3)4/h11-12,15-16H,3-10,13-14H2,1-2H3;(H2,2,3,4) |
| InChIKey | OAOSZMLHUAKTGH-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|