C24H40O5 — CID 157253642
carboxy hydrogen carbonate;1,2-dioctylbenzene (PubChem CID 157253642) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is carboxy hydrogen carbonate;1,2-dioctylbenzene.
| Compound Name | carboxy hydrogen carbonate;1,2-dioctylbenzene |
|---|---|
| PubChem CID | 157253642 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | carboxy hydrogen carbonate;1,2-dioctylbenzene |
| SMILES | CCCCCCCCc1ccccc1CCCCCCCC.O=C(O)OC(=O)O |
| InChI | InChI=1S/C22H38.C2H2O5/c1-3-5-7-9-11-13-17-21-19-15-16-20-22(21)18-14-12-10-8-6-4-2;3-1(4)7-2(5)6/h15-16,19-20H,3-14,17-18H2,1-2H3;(H,3,4)(H,5,6) |
| InChIKey | AWPXDAAOIVXPEM-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|