About 1-nonyl-2-pentylbenzene
1-nonyl-2-pentylbenzene (PubChem CID 54050070) has the molecular formula C20H34
and a molecular weight of 274.49 g/mol. Its IUPAC name is 1-nonyl-2-pentylbenzene.
Molecular Properties
| Compound Name | 1-nonyl-2-pentylbenzene |
| PubChem CID | 54050070 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 1-nonyl-2-pentylbenzene |
| SMILES | CCCCCCCCCc1ccccc1CCCCC |
| InChI | InChI=1S/C20H34/c1-3-5-7-8-9-10-12-16-20-18-14-13-17-19(20)15-11-6-4-2/h13-14,17-18H,3-12,15-16H2,1-2H3 |
| InChIKey | OPDYCMAJNGAXDF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-nonyl-2-pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nonyl-2-pentylbenzene?
The IUPAC name of 1-nonyl-2-pentylbenzene (CID 54050070) is 1-nonyl-2-pentylbenzene.
What is the SMILES notation for 1-nonyl-2-pentylbenzene?
The canonical SMILES for 1-nonyl-2-pentylbenzene is CCCCCCCCCc1ccccc1CCCCC.
What is the InChIKey of 1-nonyl-2-pentylbenzene?
The InChIKey is OPDYCMAJNGAXDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H34/c1-3-5-7-8-9-10-12-16-20-18-14-13-17-19(20)15-11-6-4-2/h13-14,17-18H,3-12,15-16H2,1-2H3.
What are the key properties of 1-nonyl-2-pentylbenzene?
1-nonyl-2-pentylbenzene has a molecular weight of 274.49 g/mol, XLogP of 6.71, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonyl-2-pentylbenzene is sourced from PubChem (CID 54050070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).