About 1,2-dihexylbenzene;hydrate
1,2-dihexylbenzene;hydrate (PubChem CID 172833093) has the molecular formula C18H32O
and a molecular weight of 264.45 g/mol. Its IUPAC name is 1,2-dihexylbenzene;hydrate.
Molecular Properties
| Compound Name | 1,2-dihexylbenzene;hydrate |
| PubChem CID | 172833093 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1,2-dihexylbenzene;hydrate |
| SMILES | CCCCCCc1ccccc1CCCCCC.O |
| InChI | InChI=1S/C18H30.H2O/c1-3-5-7-9-13-17-15-11-12-16-18(17)14-10-8-6-4-2;/h11-12,15-16H,3-10,13-14H2,1-2H3;1H2 |
| InChIKey | NMWNFQWHZFYTCD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dihexylbenzene;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihexylbenzene;hydrate?
The IUPAC name of 1,2-dihexylbenzene;hydrate (CID 172833093) is 1,2-dihexylbenzene;hydrate.
What is the SMILES notation for 1,2-dihexylbenzene;hydrate?
The canonical SMILES for 1,2-dihexylbenzene;hydrate is CCCCCCc1ccccc1CCCCCC.O.
What is the InChIKey of 1,2-dihexylbenzene;hydrate?
The InChIKey is NMWNFQWHZFYTCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30.H2O/c1-3-5-7-9-13-17-15-11-12-16-18(17)14-10-8-6-4-2;/h11-12,15-16H,3-10,13-14H2,1-2H3;1H2.
What are the key properties of 1,2-dihexylbenzene;hydrate?
1,2-dihexylbenzene;hydrate has a molecular weight of 264.45 g/mol, XLogP of 5.11, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihexylbenzene;hydrate is sourced from PubChem (CID 172833093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).