C24H42O6 — CID 174715227
carbonic acid;1,2-dioctylbenzene (PubChem CID 174715227) has the molecular formula C24H42O6 and a molecular weight of 426.59 g/mol. Its IUPAC name is carbonic acid;1,2-dioctylbenzene.
| Compound Name | carbonic acid;1,2-dioctylbenzene |
|---|---|
| PubChem CID | 174715227 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | carbonic acid;1,2-dioctylbenzene |
| SMILES | CCCCCCCCc1ccccc1CCCCCCCC.O=C(O)O.O=C(O)O |
| InChI | InChI=1S/C22H38.2CH2O3/c1-3-5-7-9-11-13-17-21-19-15-16-20-22(21)18-14-12-10-8-6-4-2;2*2-1(3)4/h15-16,19-20H,3-14,17-18H2,1-2H3;2*(H2,2,3,4) |
| InChIKey | AICFIARNPBKPJA-UHFFFAOYSA-N |
| XLogP | 7.94 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|