About carbonic acid;1-hexyl-2-phenylbenzene
carbonic acid;1-hexyl-2-phenylbenzene (PubChem CID 67180533) has the molecular formula C19H24O3
and a molecular weight of 300.40 g/mol. Its IUPAC name is carbonic acid;1-hexyl-2-phenylbenzene.
Molecular Properties
| Compound Name | carbonic acid;1-hexyl-2-phenylbenzene |
| PubChem CID | 67180533 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | carbonic acid;1-hexyl-2-phenylbenzene |
| SMILES | CCCCCCc1ccccc1-c1ccccc1.O=C(O)O |
| InChI | InChI=1S/C18H22.CH2O3/c1-2-3-4-6-11-17-14-9-10-15-18(17)16-12-7-5-8-13-16;2-1(3)4/h5,7-10,12-15H,2-4,6,11H2,1H3;(H2,2,3,4) |
| InChIKey | FSJUTAHQWGTNSY-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze carbonic acid;1-hexyl-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;1-hexyl-2-phenylbenzene?
The IUPAC name of carbonic acid;1-hexyl-2-phenylbenzene (CID 67180533) is carbonic acid;1-hexyl-2-phenylbenzene.
What is the SMILES notation for carbonic acid;1-hexyl-2-phenylbenzene?
The canonical SMILES for carbonic acid;1-hexyl-2-phenylbenzene is CCCCCCc1ccccc1-c1ccccc1.O=C(O)O.
What is the InChIKey of carbonic acid;1-hexyl-2-phenylbenzene?
The InChIKey is FSJUTAHQWGTNSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22.CH2O3/c1-2-3-4-6-11-17-14-9-10-15-18(17)16-12-7-5-8-13-16;2-1(3)4/h5,7-10,12-15H,2-4,6,11H2,1H3;(H2,2,3,4).
What are the key properties of carbonic acid;1-hexyl-2-phenylbenzene?
carbonic acid;1-hexyl-2-phenylbenzene has a molecular weight of 300.40 g/mol, XLogP of 5.70, 6 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;1-hexyl-2-phenylbenzene is sourced from PubChem (CID 67180533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).