About acetic acid;1-hexyl-2-phenylbenzene
acetic acid;1-hexyl-2-phenylbenzene (PubChem CID 155168340) has the molecular formula C20H26O2
and a molecular weight of 298.43 g/mol. Its IUPAC name is acetic acid;1-hexyl-2-phenylbenzene.
Molecular Properties
| Compound Name | acetic acid;1-hexyl-2-phenylbenzene |
| PubChem CID | 155168340 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | acetic acid;1-hexyl-2-phenylbenzene |
| SMILES | CC(=O)O.CCCCCCc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C18H22.C2H4O2/c1-2-3-4-6-11-17-14-9-10-15-18(17)16-12-7-5-8-13-16;1-2(3)4/h5,7-10,12-15H,2-4,6,11H2,1H3;1H3,(H,3,4) |
| InChIKey | MSICGQQFOWOBHV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-hexyl-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-hexyl-2-phenylbenzene?
The IUPAC name of acetic acid;1-hexyl-2-phenylbenzene (CID 155168340) is acetic acid;1-hexyl-2-phenylbenzene.
What is the SMILES notation for acetic acid;1-hexyl-2-phenylbenzene?
The canonical SMILES for acetic acid;1-hexyl-2-phenylbenzene is CC(=O)O.CCCCCCc1ccccc1-c1ccccc1.
What is the InChIKey of acetic acid;1-hexyl-2-phenylbenzene?
The InChIKey is MSICGQQFOWOBHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22.C2H4O2/c1-2-3-4-6-11-17-14-9-10-15-18(17)16-12-7-5-8-13-16;1-2(3)4/h5,7-10,12-15H,2-4,6,11H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-hexyl-2-phenylbenzene?
acetic acid;1-hexyl-2-phenylbenzene has a molecular weight of 298.43 g/mol, XLogP of 5.57, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-hexyl-2-phenylbenzene is sourced from PubChem (CID 155168340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).