About gold;1-pentyl-2-phenylbenzene
gold;1-pentyl-2-phenylbenzene (PubChem CID 174945702) has the molecular formula C17H20Au
and a molecular weight of 421.31 g/mol. Its IUPAC name is gold;1-pentyl-2-phenylbenzene.
Molecular Properties
| Compound Name | gold;1-pentyl-2-phenylbenzene |
| PubChem CID | 174945702 |
| Molecular Formula | C17H20Au |
| Molecular Weight | 421.31 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | gold;1-pentyl-2-phenylbenzene |
| SMILES | CCCCCc1ccccc1-c1ccccc1.[Au] |
| InChI | InChI=1S/C17H20.Au/c1-2-3-5-10-15-13-8-9-14-17(15)16-11-6-4-7-12-16;/h4,6-9,11-14H,2-3,5,10H2,1H3; |
| InChIKey | LEZHHDUOOAZOGG-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.31 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze gold;1-pentyl-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gold;1-pentyl-2-phenylbenzene?
The IUPAC name of gold;1-pentyl-2-phenylbenzene (CID 174945702) is gold;1-pentyl-2-phenylbenzene.
What is the SMILES notation for gold;1-pentyl-2-phenylbenzene?
The canonical SMILES for gold;1-pentyl-2-phenylbenzene is CCCCCc1ccccc1-c1ccccc1.[Au].
What is the InChIKey of gold;1-pentyl-2-phenylbenzene?
The InChIKey is LEZHHDUOOAZOGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20.Au/c1-2-3-5-10-15-13-8-9-14-17(15)16-11-6-4-7-12-16;/h4,6-9,11-14H,2-3,5,10H2,1H3;.
What are the key properties of gold;1-pentyl-2-phenylbenzene?
gold;1-pentyl-2-phenylbenzene has a molecular weight of 421.31 g/mol, XLogP of 5.08, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for gold;1-pentyl-2-phenylbenzene is sourced from PubChem (CID 174945702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).