About 1-butyl-2-phenylbenzene;chlorosilane
1-butyl-2-phenylbenzene;chlorosilane (PubChem CID 157433440) has the molecular formula C16H21ClSi
and a molecular weight of 276.88 g/mol. Its IUPAC name is 1-butyl-2-phenylbenzene;chlorosilane.
Molecular Properties
| Compound Name | 1-butyl-2-phenylbenzene;chlorosilane |
| PubChem CID | 157433440 |
| Molecular Formula | C16H21ClSi |
| Molecular Weight | 276.88 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 1-butyl-2-phenylbenzene;chlorosilane |
| SMILES | CCCCc1ccccc1-c1ccccc1.[SiH3]Cl |
| InChI | InChI=1S/C16H18.ClH3Si/c1-2-3-9-14-12-7-8-13-16(14)15-10-5-4-6-11-15;1-2/h4-8,10-13H,2-3,9H2,1H3;2H3 |
| InChIKey | BQUXKQYHLGIUEN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.88 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-2-phenylbenzene;chlorosilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-2-phenylbenzene;chlorosilane?
The IUPAC name of 1-butyl-2-phenylbenzene;chlorosilane (CID 157433440) is 1-butyl-2-phenylbenzene;chlorosilane.
What is the SMILES notation for 1-butyl-2-phenylbenzene;chlorosilane?
The canonical SMILES for 1-butyl-2-phenylbenzene;chlorosilane is CCCCc1ccccc1-c1ccccc1.[SiH3]Cl.
What is the InChIKey of 1-butyl-2-phenylbenzene;chlorosilane?
The InChIKey is BQUXKQYHLGIUEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18.ClH3Si/c1-2-3-9-14-12-7-8-13-16(14)15-10-5-4-6-11-15;1-2/h4-8,10-13H,2-3,9H2,1H3;2H3.
What are the key properties of 1-butyl-2-phenylbenzene;chlorosilane?
1-butyl-2-phenylbenzene;chlorosilane has a molecular weight of 276.88 g/mol, XLogP of 4.20, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-2-phenylbenzene;chlorosilane is sourced from PubChem (CID 157433440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).