About formonitrile;1-pentyl-2-phenylbenzene
formonitrile;1-pentyl-2-phenylbenzene (PubChem CID 67877805) has the molecular formula C18H21N
and a molecular weight of 251.37 g/mol. Its IUPAC name is formonitrile;1-pentyl-2-phenylbenzene.
Molecular Properties
| Compound Name | formonitrile;1-pentyl-2-phenylbenzene |
| PubChem CID | 67877805 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | formonitrile;1-pentyl-2-phenylbenzene |
| SMILES | C#N.CCCCCc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C17H20.CHN/c1-2-3-5-10-15-13-8-9-14-17(15)16-11-6-4-7-12-16;1-2/h4,6-9,11-14H,2-3,5,10H2,1H3;1H |
| InChIKey | BFINQODGRLNSLM-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze formonitrile;1-pentyl-2-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formonitrile;1-pentyl-2-phenylbenzene?
The IUPAC name of formonitrile;1-pentyl-2-phenylbenzene (CID 67877805) is formonitrile;1-pentyl-2-phenylbenzene.
What is the SMILES notation for formonitrile;1-pentyl-2-phenylbenzene?
The canonical SMILES for formonitrile;1-pentyl-2-phenylbenzene is C#N.CCCCCc1ccccc1-c1ccccc1.
What is the InChIKey of formonitrile;1-pentyl-2-phenylbenzene?
The InChIKey is BFINQODGRLNSLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20.CHN/c1-2-3-5-10-15-13-8-9-14-17(15)16-11-6-4-7-12-16;1-2/h4,6-9,11-14H,2-3,5,10H2,1H3;1H.
What are the key properties of formonitrile;1-pentyl-2-phenylbenzene?
formonitrile;1-pentyl-2-phenylbenzene has a molecular weight of 251.37 g/mol, XLogP of 5.23, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formonitrile;1-pentyl-2-phenylbenzene is sourced from PubChem (CID 67877805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).