C24H31N — CID 70430440
2-cyclohexyl-1-pentyl-3-phenylbenzene;formonitrile (PubChem CID 70430440) has the molecular formula C24H31N and a molecular weight of 333.52 g/mol. Its IUPAC name is 2-cyclohexyl-1-pentyl-3-phenylbenzene;formonitrile.
| Compound Name | 2-cyclohexyl-1-pentyl-3-phenylbenzene;formonitrile |
|---|---|
| PubChem CID | 70430440 |
| Molecular Formula | C24H31N |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.25 |
| IUPAC Name | 2-cyclohexyl-1-pentyl-3-phenylbenzene;formonitrile |
| SMILES | C#N.CCCCCc1cccc(-c2ccccc2)c1C1CCCCC1 |
| InChI | InChI=1S/C23H30.CHN/c1-2-3-6-14-21-17-11-18-22(19-12-7-4-8-13-19)23(21)20-15-9-5-10-16-20;1-2/h4,7-8,11-13,17-18,20H,2-3,5-6,9-10,14-16H2,1H3;1H |
| InChIKey | ILYRYQDCRMFXQH-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|